C24H32N2O3 — CID 177024691
5-[4-(cyclopentylamino)-2-methylphenoxy]-N-(3-methoxypropyl)-2-methylbenzamide (PubChem CID 177024691) has the molecular formula C24H32N2O3 and a molecular weight of 396.53 g/mol. Its IUPAC name is 5-[4-(cyclopentylamino)-2-methylphenoxy]-N-(3-methoxypropyl)-2-methylbenzamide.
| Compound Name | 5-[4-(cyclopentylamino)-2-methylphenoxy]-N-(3-methoxypropyl)-2-methylbenzamide |
|---|---|
| PubChem CID | 177024691 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | 5-[4-(cyclopentylamino)-2-methylphenoxy]-N-(3-methoxypropyl)-2-methylbenzamide |
| SMILES | COCCCNC(=O)c1cc(Oc2ccc(NC3CCCC3)cc2C)ccc1C |
| InChI | InChI=1S/C24H32N2O3/c1-17-9-11-21(16-22(17)24(27)25-13-6-14-28-3)29-23-12-10-20(15-18(23)2)26-19-7-4-5-8-19/h9-12,15-16,19,26H,4-8,13-14H2,1-3H3,(H,25,27) |
| InChIKey | PNQVQCHKUOCSPL-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|