C26H34N2O3 — CID 177024702
4-[4-[acetyl(cyclopentyl)amino]-2-methylphenoxy]-N-butyl-2-methylbenzamide (PubChem CID 177024702) has the molecular formula C26H34N2O3 and a molecular weight of 422.57 g/mol. Its IUPAC name is 4-[4-[acetyl(cyclopentyl)amino]-2-methylphenoxy]-N-butyl-2-methylbenzamide.
| Compound Name | 4-[4-[acetyl(cyclopentyl)amino]-2-methylphenoxy]-N-butyl-2-methylbenzamide |
|---|---|
| PubChem CID | 177024702 |
| Molecular Formula | C26H34N2O3 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | 4-[4-[acetyl(cyclopentyl)amino]-2-methylphenoxy]-N-butyl-2-methylbenzamide |
| SMILES | CCCCNC(=O)c1ccc(Oc2ccc(N(C(C)=O)C3CCCC3)cc2C)cc1C |
| InChI | InChI=1S/C26H34N2O3/c1-5-6-15-27-26(30)24-13-12-23(17-18(24)2)31-25-14-11-22(16-19(25)3)28(20(4)29)21-9-7-8-10-21/h11-14,16-17,21H,5-10,15H2,1-4H3,(H,27,30) |
| InChIKey | GPWXVXASQATUNQ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|