C26H25N7O2 — CID 177025741
1-(6-imino-1-methanimidoylpyridazin-3-yl)-3-methyl-4-[3-[(3-methylphenyl)methoxy]phenyl]-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one (PubChem CID 177025741) has the molecular formula C26H25N7O2 and a molecular weight of 467.53 g/mol. Its IUPAC name is 1-(6-imino-1-methanimidoylpyridazin-3-yl)-3-methyl-4-[3-[(3-methylphenyl)methoxy]phenyl]-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one.
| Compound Name | 1-(6-imino-1-methanimidoylpyridazin-3-yl)-3-methyl-4-[3-[(3-methylphenyl)methoxy]phenyl]-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one |
|---|---|
| PubChem CID | 177025741 |
| Molecular Formula | C26H25N7O2 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 1-(6-imino-1-methanimidoylpyridazin-3-yl)-3-methyl-4-[3-[(3-methylphenyl)methoxy]phenyl]-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one |
| SMILES | [H]/N=C/n1nc(-n2nc(C)c3c2NC(=O)CC3c2cccc(OCc3cccc(C)c3)c2)cc/c1=N\[H] |
| InChI | InChI=1S/C26H25N7O2/c1-16-5-3-6-18(11-16)14-35-20-8-4-7-19(12-20)21-13-24(34)29-26-25(21)17(2)30-33(26)23-10-9-22(28)32(15-27)31-23/h3-12,15,21,27-28H,13-14H2,1-2H3,(H,29,34)/b27-15+,28-22+ |
| InChIKey | UDCRXJDGDWJOLX-FBXQPAQYSA-N |
| XLogP | 3.67 |
| TPSA | 121.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|