C26H33F6N5O3 — CID 177025816
tert-butyl N-[(S)-[5-[cyclopropyl-[(2-diazenyl-3,3,3-trifluoropropyl)amino]methyl]-4-fluoro-1,3-benzoxazol-2-yl]-(4,4-difluorocyclohexyl)methyl]carbamate (PubChem CID 177025816) has the molecular formula C26H33F6N5O3 and a molecular weight of 577.57 g/mol. Its IUPAC name is tert-butyl N-[(S)-[5-[cyclopropyl-[(2-diazenyl-3,3,3-trifluoropropyl)amino]methyl]-4-fluoro-1,3-benzoxazol-2-yl]-(4,4-difluorocyclohexyl)methyl]carbamate.
| Compound Name | tert-butyl N-[(S)-[5-[cyclopropyl-[(2-diazenyl-3,3,3-trifluoropropyl)amino]methyl]-4-fluoro-1,3-benzoxazol-2-yl]-(4,4-difluorocyclohexyl)methyl]carbamate |
|---|---|
| PubChem CID | 177025816 |
| Molecular Formula | C26H33F6N5O3 |
| Molecular Weight | 577.57 g/mol |
| Exact Mass | 577.25 |
| IUPAC Name | tert-butyl N-[(S)-[5-[cyclopropyl-[(2-diazenyl-3,3,3-trifluoropropyl)amino]methyl]-4-fluoro-1,3-benzoxazol-2-yl]-(4,4-difluorocyclohexyl)methyl]carbamate |
| SMILES | [H]/N=N/C(CNC(c1ccc2oc([C@@H](NC(=O)OC(C)(C)C)C3CCC(F)(F)CC3)nc2c1F)C1CC1)C(F)(F)F |
| InChI | InChI=1S/C26H33F6N5O3/c1-24(2,3)40-23(38)36-20(14-8-10-25(28,29)11-9-14)22-35-21-16(39-22)7-6-15(18(21)27)19(13-4-5-13)34-12-17(37-33)26(30,31)32/h6-7,13-14,17,19-20,33-34H,4-5,8-12H2,1-3H3,(H,36,38)/b37-33+/t17?,19?,20-/m0/s1 |
| InChIKey | UAMQJZPOAFGNRX-IOFGYYCYSA-N |
| XLogP | 7.36 |
| TPSA | 112.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.57 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|