About N-methyl-3-morpholin-4-ylpropan-1-amine;2-propan-2-ylmorpholine
N-methyl-3-morpholin-4-ylpropan-1-amine;2-propan-2-ylmorpholine (PubChem CID 177026152) has the molecular formula C15H33N3O2
and a molecular weight of 287.45 g/mol. Its IUPAC name is N-methyl-3-morpholin-4-ylpropan-1-amine;2-propan-2-ylmorpholine.
Molecular Properties
| Compound Name | N-methyl-3-morpholin-4-ylpropan-1-amine;2-propan-2-ylmorpholine |
| PubChem CID | 177026152 |
| Molecular Formula | C15H33N3O2 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.26 |
| IUPAC Name | N-methyl-3-morpholin-4-ylpropan-1-amine;2-propan-2-ylmorpholine |
| SMILES | CC(C)C1CNCCO1.CNCCCN1CCOCC1 |
| InChI | InChI=1S/C8H18N2O.C7H15NO/c1-9-3-2-4-10-5-7-11-8-6-10;1-6(2)7-5-8-3-4-9-7/h9H,2-8H2,1H3;6-8H,3-5H2,1-2H3 |
| InChIKey | XACNXRQFSUUNBA-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-3-morpholin-4-ylpropan-1-amine;2-propan-2-ylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-3-morpholin-4-ylpropan-1-amine;2-propan-2-ylmorpholine?
The IUPAC name of N-methyl-3-morpholin-4-ylpropan-1-amine;2-propan-2-ylmorpholine (CID 177026152) is N-methyl-3-morpholin-4-ylpropan-1-amine;2-propan-2-ylmorpholine.
What is the SMILES notation for N-methyl-3-morpholin-4-ylpropan-1-amine;2-propan-2-ylmorpholine?
The canonical SMILES for N-methyl-3-morpholin-4-ylpropan-1-amine;2-propan-2-ylmorpholine is CC(C)C1CNCCO1.CNCCCN1CCOCC1.
What is the InChIKey of N-methyl-3-morpholin-4-ylpropan-1-amine;2-propan-2-ylmorpholine?
The InChIKey is XACNXRQFSUUNBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O.C7H15NO/c1-9-3-2-4-10-5-7-11-8-6-10;1-6(2)7-5-8-3-4-9-7/h9H,2-8H2,1H3;6-8H,3-5H2,1-2H3.
What are the key properties of N-methyl-3-morpholin-4-ylpropan-1-amine;2-propan-2-ylmorpholine?
N-methyl-3-morpholin-4-ylpropan-1-amine;2-propan-2-ylmorpholine has a molecular weight of 287.45 g/mol, XLogP of 0.56, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-3-morpholin-4-ylpropan-1-amine;2-propan-2-ylmorpholine is sourced from PubChem (CID 177026152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).