C19H17Cl3N4O4 — CID 177026253
[4-(4-chloro-5-nitro-3-pyridinyl)morpholin-2-yl]-(6,8-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)methanone (PubChem CID 177026253) has the molecular formula C19H17Cl3N4O4 and a molecular weight of 471.73 g/mol. Its IUPAC name is [4-(4-chloro-5-nitro-3-pyridinyl)morpholin-2-yl]-(6,8-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)methanone.
| Compound Name | [4-(4-chloro-5-nitro-3-pyridinyl)morpholin-2-yl]-(6,8-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)methanone |
|---|---|
| PubChem CID | 177026253 |
| Molecular Formula | C19H17Cl3N4O4 |
| Molecular Weight | 471.73 g/mol |
| Exact Mass | 470.03 |
| IUPAC Name | [4-(4-chloro-5-nitro-3-pyridinyl)morpholin-2-yl]-(6,8-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)methanone |
| SMILES | O=C(C1CN(c2cncc([N+](=O)[O-])c2Cl)CCO1)N1CCc2cc(Cl)cc(Cl)c2C1 |
| InChI | InChI=1S/C19H17Cl3N4O4/c20-12-5-11-1-2-25(9-13(11)14(21)6-12)19(27)17-10-24(3-4-30-17)15-7-23-8-16(18(15)22)26(28)29/h5-8,17H,1-4,9-10H2 |
| InChIKey | XUGYQQAEYJEUTE-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.73 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|