C38H43Cl2N5O8 — CID 177026250
2-N,2-N-bis[(2,4-dimethoxyphenyl)methyl]-5-nitropyridine-2,4-diamine;(6,8-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)-(oxan-2-yl)methanone (PubChem CID 177026250) has the molecular formula C38H43Cl2N5O8 and a molecular weight of 768.70 g/mol. Its IUPAC name is 2-N,2-N-bis[(2,4-dimethoxyphenyl)methyl]-5-nitropyridine-2,4-diamine;(6,8-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)-(oxan-2-yl)methanone.
| Compound Name | 2-N,2-N-bis[(2,4-dimethoxyphenyl)methyl]-5-nitropyridine-2,4-diamine;(6,8-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)-(oxan-2-yl)methanone |
|---|---|
| PubChem CID | 177026250 |
| Molecular Formula | C38H43Cl2N5O8 |
| Molecular Weight | 768.70 g/mol |
| Exact Mass | 767.25 |
| IUPAC Name | 2-N,2-N-bis[(2,4-dimethoxyphenyl)methyl]-5-nitropyridine-2,4-diamine;(6,8-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)-(oxan-2-yl)methanone |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2OC)c2cc(N)c([N+](=O)[O-])cn2)c(OC)c1.O=C(C1CCCCO1)N1CCc2cc(Cl)cc(Cl)c2C1 |
| InChI | InChI=1S/C23H26N4O6.C15H17Cl2NO2/c1-30-17-7-5-15(21(9-17)32-3)13-26(23-11-19(24)20(12-25-23)27(28)29)14-16-6-8-18(31-2)10-22(16)33-4;16-11-7-10-4-5-18(9-12(10)13(17)8-11)15(19)14-3-1-2-6-20-14/h5-12H,13-14H2,1-4H3,(H2,24,25);7-8,14H,1-6,9H2 |
| InChIKey | HCOXXWBGSZXFII-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 151.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.70 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|