C39H40Cl2N4O8 — CID 177026099
[4-[2-[bis[(2,4-dimethoxyphenyl)methyl]amino]-[1,3]oxazolo[4,5-c]pyridin-7-yl]-4-hydroxyoxan-2-yl]-(6,8-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)methanone (PubChem CID 177026099) has the molecular formula C39H40Cl2N4O8 and a molecular weight of 763.68 g/mol. Its IUPAC name is [4-[2-[bis[(2,4-dimethoxyphenyl)methyl]amino]-[1,3]oxazolo[4,5-c]pyridin-7-yl]-4-hydroxyoxan-2-yl]-(6,8-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)methanone.
| Compound Name | [4-[2-[bis[(2,4-dimethoxyphenyl)methyl]amino]-[1,3]oxazolo[4,5-c]pyridin-7-yl]-4-hydroxyoxan-2-yl]-(6,8-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)methanone |
|---|---|
| PubChem CID | 177026099 |
| Molecular Formula | C39H40Cl2N4O8 |
| Molecular Weight | 763.68 g/mol |
| Exact Mass | 762.22 |
| IUPAC Name | [4-[2-[bis[(2,4-dimethoxyphenyl)methyl]amino]-[1,3]oxazolo[4,5-c]pyridin-7-yl]-4-hydroxyoxan-2-yl]-(6,8-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)methanone |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2OC)c2nc3cncc(C4(O)CCOC(C(=O)N5CCc6cc(Cl)cc(Cl)c6C5)C4)c3o2)c(OC)c1 |
| InChI | InChI=1S/C39H40Cl2N4O8/c1-48-27-7-5-24(33(15-27)50-3)20-45(21-25-6-8-28(49-2)16-34(25)51-4)38-43-32-19-42-18-30(36(32)53-38)39(47)10-12-52-35(17-39)37(46)44-11-9-23-13-26(40)14-31(41)29(23)22-44/h5-8,13-16,18-19,35,47H,9-12,17,20-22H2,1-4H3 |
| InChIKey | IYBBQHBXYHNXCN-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 128.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.68 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |