C22H22F5N3O2 — CID 177027077
N-cyclobutyl-2-(3,5-difluorophenyl)-5-iminopyrrolidine-1-carboxamide;4-(trifluoromethyl)phenol (PubChem CID 177027077) has the molecular formula C22H22F5N3O2 and a molecular weight of 455.43 g/mol. Its IUPAC name is N-cyclobutyl-2-(3,5-difluorophenyl)-5-iminopyrrolidine-1-carboxamide;4-(trifluoromethyl)phenol.
| Compound Name | N-cyclobutyl-2-(3,5-difluorophenyl)-5-iminopyrrolidine-1-carboxamide;4-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 177027077 |
| Molecular Formula | C22H22F5N3O2 |
| Molecular Weight | 455.43 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | N-cyclobutyl-2-(3,5-difluorophenyl)-5-iminopyrrolidine-1-carboxamide;4-(trifluoromethyl)phenol |
| SMILES | Oc1ccc(C(F)(F)F)cc1.[H]/N=C1\CCC(c2cc(F)cc(F)c2)N1C(=O)NC1CCC1 |
| InChI | InChI=1S/C15H17F2N3O.C7H5F3O/c16-10-6-9(7-11(17)8-10)13-4-5-14(18)20(13)15(21)19-12-2-1-3-12;8-7(9,10)5-1-3-6(11)4-2-5/h6-8,12-13,18H,1-5H2,(H,19,21);1-4,11H/b18-14+; |
| InChIKey | KPTOFRVSRKNYCD-LSJACRKWSA-N |
| XLogP | 5.75 |
| TPSA | 76.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.43 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|