C20H24F3N4NaO3 — CID 178148927
sodium 1-(4-hydroxybenzenecarboximidoyl)-3-[2-(4-hydroxy-4-methylcyclohexen-1-yl)-2-iminoethyl]-1-(3,3,3-trifluoropropyl)urea (PubChem CID 178148927) has the molecular formula C20H24F3N4NaO3 and a molecular weight of 448.42 g/mol. Its IUPAC name is sodium 1-(4-hydroxybenzenecarboximidoyl)-3-[2-(4-hydroxy-4-methylcyclohexen-1-yl)-2-iminoethyl]-1-(3,3,3-trifluoropropyl)urea.
| Compound Name | sodium 1-(4-hydroxybenzenecarboximidoyl)-3-[2-(4-hydroxy-4-methylcyclohexen-1-yl)-2-iminoethyl]-1-(3,3,3-trifluoropropyl)urea |
|---|---|
| PubChem CID | 178148927 |
| Molecular Formula | C20H24F3N4NaO3 |
| Molecular Weight | 448.42 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | sodium 1-(4-hydroxybenzenecarboximidoyl)-3-[2-(4-hydroxy-4-methylcyclohexen-1-yl)-2-iminoethyl]-1-(3,3,3-trifluoropropyl)urea |
| SMILES | [H]/N=C(\CNC(=O)N(CCC(F)(F)F)/C(=N/[H])c1ccc(O)cc1)C1=[C-]CC(C)(O)CC1.[Na+] |
| InChI | InChI=1S/C20H24F3N4O3.Na/c1-19(30)8-6-13(7-9-19)16(24)12-26-18(29)27(11-10-20(21,22)23)17(25)14-2-4-15(28)5-3-14;/h2-5,24-25,28,30H,6,8-12H2,1H3,(H,26,29);/q-1;+1/b24-16+,25-17+; |
| InChIKey | DWYNCAWNLWZEMM-MTGLEZRPSA-N |
| XLogP | 0.37 |
| TPSA | 120.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.42 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|