C21H25F3N4O4 — CID 178148571
4-[2-[[(4-hydroxybenzenecarboximidoyl)-(3,3,3-trifluoropropyl)carbamoyl]amino]ethanimidoyl]-1-methylcyclohex-3-ene-1-carboxylic acid (PubChem CID 178148571) has the molecular formula C21H25F3N4O4 and a molecular weight of 454.45 g/mol. Its IUPAC name is 4-[2-[[(4-hydroxybenzenecarboximidoyl)-(3,3,3-trifluoropropyl)carbamoyl]amino]ethanimidoyl]-1-methylcyclohex-3-ene-1-carboxylic acid.
| Compound Name | 4-[2-[[(4-hydroxybenzenecarboximidoyl)-(3,3,3-trifluoropropyl)carbamoyl]amino]ethanimidoyl]-1-methylcyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 178148571 |
| Molecular Formula | C21H25F3N4O4 |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 4-[2-[[(4-hydroxybenzenecarboximidoyl)-(3,3,3-trifluoropropyl)carbamoyl]amino]ethanimidoyl]-1-methylcyclohex-3-ene-1-carboxylic acid |
| SMILES | [H]/N=C(\CNC(=O)N(CCC(F)(F)F)/C(=N/[H])c1ccc(O)cc1)C1=CCC(C)(C(=O)O)CC1 |
| InChI | InChI=1S/C21H25F3N4O4/c1-20(18(30)31)8-6-13(7-9-20)16(25)12-27-19(32)28(11-10-21(22,23)24)17(26)14-2-4-15(29)5-3-14/h2-6,25-26,29H,7-12H2,1H3,(H,27,32)(H,30,31)/b25-16+,26-17+ |
| InChIKey | BNNSZRYCOURGSV-ZZZAPRPPSA-N |
| XLogP | 3.90 |
| TPSA | 137.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|