C28H35ClF3N5O3 — CID 178148931
3-[(2Z)-2-amino-2-[2-[(4E,6E)-6-chloronona-4,6,8-trien-4-yl]imino-4-hydroxycyclohexylidene]ethyl]-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea (PubChem CID 178148931) has the molecular formula C28H35ClF3N5O3 and a molecular weight of 582.07 g/mol. Its IUPAC name is 3-[(2Z)-2-amino-2-[2-[(4E,6E)-6-chloronona-4,6,8-trien-4-yl]imino-4-hydroxycyclohexylidene]ethyl]-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea.
| Compound Name | 3-[(2Z)-2-amino-2-[2-[(4E,6E)-6-chloronona-4,6,8-trien-4-yl]imino-4-hydroxycyclohexylidene]ethyl]-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea |
|---|---|
| PubChem CID | 178148931 |
| Molecular Formula | C28H35ClF3N5O3 |
| Molecular Weight | 582.07 g/mol |
| Exact Mass | 581.24 |
| IUPAC Name | 3-[(2Z)-2-amino-2-[2-[(4E,6E)-6-chloronona-4,6,8-trien-4-yl]imino-4-hydroxycyclohexylidene]ethyl]-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea |
| SMILES | [H]/N=C(\c1ccc(O)cc1)N(CCC(F)(F)F)C(=O)NC/C(N)=C1\CCC(O)C\C1=N/C(=C/C(Cl)=C\C=C)CCC |
| InChI | InChI=1S/C28H35ClF3N5O3/c1-3-5-19(29)15-20(6-4-2)36-25-16-22(39)11-12-23(25)24(33)17-35-27(40)37(14-13-28(30,31)32)26(34)18-7-9-21(38)10-8-18/h3,5,7-10,15,22,34,38-39H,1,4,6,11-14,16-17,33H2,2H3,(H,35,40)/b19-5+,20-15+,24-23-,34-26+,36-25+ |
| InChIKey | ATVNBGMTPNXSSV-VJMVSYITSA-N |
| XLogP | 5.87 |
| TPSA | 135.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.07 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|