C15H23F3N2O3 — CID 178148393
ethane;N-(4-hydroxybenzenecarboximidoyl)-N-(3,3,3-trifluoropropyl)acetamide;methanol (PubChem CID 178148393) has the molecular formula C15H23F3N2O3 and a molecular weight of 336.35 g/mol. Its IUPAC name is ethane;N-(4-hydroxybenzenecarboximidoyl)-N-(3,3,3-trifluoropropyl)acetamide;methanol.
| Compound Name | ethane;N-(4-hydroxybenzenecarboximidoyl)-N-(3,3,3-trifluoropropyl)acetamide;methanol |
|---|---|
| PubChem CID | 178148393 |
| Molecular Formula | C15H23F3N2O3 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | ethane;N-(4-hydroxybenzenecarboximidoyl)-N-(3,3,3-trifluoropropyl)acetamide;methanol |
| SMILES | CC.CO.[H]/N=C(/c1ccc(O)cc1)N(CCC(F)(F)F)C(C)=O |
| InChI | InChI=1S/C12H13F3N2O2.C2H6.CH4O/c1-8(18)17(7-6-12(13,14)15)11(16)9-2-4-10(19)5-3-9;2*1-2/h2-5,16,19H,6-7H2,1H3;1-2H3;2H,1H3/b16-11-;; |
| InChIKey | GNAAVDZBUNROAI-BAJNHPLUSA-N |
| XLogP | 3.15 |
| TPSA | 84.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|