C28H33ClF3N5O2 — CID 178148932
3-[(2E)-2-[3-[1-(4-chlorophenyl)propylimino]piperidin-4-ylidene]propyl]-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea (PubChem CID 178148932) has the molecular formula C28H33ClF3N5O2 and a molecular weight of 564.05 g/mol. Its IUPAC name is 3-[(2E)-2-[3-[1-(4-chlorophenyl)propylimino]piperidin-4-ylidene]propyl]-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea.
| Compound Name | 3-[(2E)-2-[3-[1-(4-chlorophenyl)propylimino]piperidin-4-ylidene]propyl]-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea |
|---|---|
| PubChem CID | 178148932 |
| Molecular Formula | C28H33ClF3N5O2 |
| Molecular Weight | 564.05 g/mol |
| Exact Mass | 563.23 |
| IUPAC Name | 3-[(2E)-2-[3-[1-(4-chlorophenyl)propylimino]piperidin-4-ylidene]propyl]-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea |
| SMILES | [H]/N=C(\c1ccc(O)cc1)N(CCC(F)(F)F)C(=O)NC/C(C)=C1\CCNC\C1=N/C(CC)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H33ClF3N5O2/c1-3-24(19-4-8-21(29)9-5-19)36-25-17-34-14-12-23(25)18(2)16-35-27(39)37(15-13-28(30,31)32)26(33)20-6-10-22(38)11-7-20/h4-11,24,33-34,38H,3,12-17H2,1-2H3,(H,35,39)/b23-18+,33-26+,36-25+ |
| InChIKey | WJYVIBNGDSEHRO-BHHCVGCPSA-N |
| XLogP | 6.24 |
| TPSA | 100.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.05 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|