C29H38F3N5O3 — CID 178148478
1-(4-hydroxybenzenecarboximidoyl)-3-[[5-hydroxy-5-methyl-3-[(3E,5Z)-5-methylocta-3,5,7-trien-3-yl]-3,4,6,7-tetrahydro-2H-indazol-1-yl]methyl]-1-(3,3,3-trifluoropropyl)urea (PubChem CID 178148478) has the molecular formula C29H38F3N5O3 and a molecular weight of 561.65 g/mol. Its IUPAC name is 1-(4-hydroxybenzenecarboximidoyl)-3-[[5-hydroxy-5-methyl-3-[(3E,5Z)-5-methylocta-3,5,7-trien-3-yl]-3,4,6,7-tetrahydro-2H-indazol-1-yl]methyl]-1-(3,3,3-trifluoropropyl)urea.
| Compound Name | 1-(4-hydroxybenzenecarboximidoyl)-3-[[5-hydroxy-5-methyl-3-[(3E,5Z)-5-methylocta-3,5,7-trien-3-yl]-3,4,6,7-tetrahydro-2H-indazol-1-yl]methyl]-1-(3,3,3-trifluoropropyl)urea |
|---|---|
| PubChem CID | 178148478 |
| Molecular Formula | C29H38F3N5O3 |
| Molecular Weight | 561.65 g/mol |
| Exact Mass | 561.29 |
| IUPAC Name | 1-(4-hydroxybenzenecarboximidoyl)-3-[[5-hydroxy-5-methyl-3-[(3E,5Z)-5-methylocta-3,5,7-trien-3-yl]-3,4,6,7-tetrahydro-2H-indazol-1-yl]methyl]-1-(3,3,3-trifluoropropyl)urea |
| SMILES | [H]/N=C(\c1ccc(O)cc1)N(CCC(F)(F)F)C(=O)NCN1NC(/C(=C/C(C)=C\C=C)CC)C2=C1CCC(C)(O)C2 |
| InChI | InChI=1S/C29H38F3N5O3/c1-5-7-19(3)16-20(6-2)25-23-17-28(4,40)13-12-24(23)37(35-25)18-34-27(39)36(15-14-29(30,31)32)26(33)21-8-10-22(38)11-9-21/h5,7-11,16,25,33,35,38,40H,1,6,12-15,17-18H2,2-4H3,(H,34,39)/b19-7-,20-16+,33-26+ |
| InChIKey | GYDMEFXZFFHBHW-VKQSVGEFSA-N |
| XLogP | 5.49 |
| TPSA | 111.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.65 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|