C11H11F3N2O2 — CID 178148471
N-(4-hydroxybenzenecarboximidoyl)-N-(3,3,3-trifluoropropyl)formamide (PubChem CID 178148471) has the molecular formula C11H11F3N2O2 and a molecular weight of 260.21 g/mol. Its IUPAC name is N-(4-hydroxybenzenecarboximidoyl)-N-(3,3,3-trifluoropropyl)formamide.
| Compound Name | N-(4-hydroxybenzenecarboximidoyl)-N-(3,3,3-trifluoropropyl)formamide |
|---|---|
| PubChem CID | 178148471 |
| Molecular Formula | C11H11F3N2O2 |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | N-(4-hydroxybenzenecarboximidoyl)-N-(3,3,3-trifluoropropyl)formamide |
| SMILES | [H]/N=C(/c1ccc(O)cc1)N(C=O)CCC(F)(F)F |
| InChI | InChI=1S/C11H11F3N2O2/c12-11(13,14)5-6-16(7-17)10(15)8-1-3-9(18)4-2-8/h1-4,7,15,18H,5-6H2/b15-10- |
| InChIKey | LAYCXHLNDDVFPJ-GDNBJRDFSA-N |
| XLogP | 2.13 |
| TPSA | 64.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|