C25H26ClF3N4NaO4- — CID 178148994
sodium;chlorobenzene;3-[2-(4,5-dihydroxycyclohexen-1-yl)-2-iminoethyl]-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea (PubChem CID 178148994) has the molecular formula C25H26ClF3N4NaO4- and a molecular weight of 561.94 g/mol. Its IUPAC name is sodium;chlorobenzene;3-[2-(4,5-dihydroxycyclohexen-1-yl)-2-iminoethyl]-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea.
| Compound Name | sodium;chlorobenzene;3-[2-(4,5-dihydroxycyclohexen-1-yl)-2-iminoethyl]-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea |
|---|---|
| PubChem CID | 178148994 |
| Molecular Formula | C25H26ClF3N4NaO4- |
| Molecular Weight | 561.94 g/mol |
| Exact Mass | 561.15 |
| IUPAC Name | sodium;chlorobenzene;3-[2-(4,5-dihydroxycyclohexen-1-yl)-2-iminoethyl]-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea |
| SMILES | Clc1c[c-]ccc1.[H]/N=C(\CNC(=O)N(CCC(F)(F)F)/C(=N/[H])c1ccc(O)cc1)C1=[C-]CC(O)C(O)C1.[Na+] |
| InChI | InChI=1S/C19H22F3N4O4.C6H4Cl.Na/c20-19(21,22)7-8-26(17(24)11-1-4-13(27)5-2-11)18(30)25-10-14(23)12-3-6-15(28)16(29)9-12;7-6-4-2-1-3-5-6;/h1-2,4-5,15-16,23-24,27-29H,6-10H2,(H,25,30);1-2,4-5H;/q2*-1;+1/b23-14+,24-17+;; |
| InChIKey | ATASZSOVODMMJI-XEMFQDATSA-N |
| XLogP | 1.09 |
| TPSA | 140.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.94 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|