C29H36ClF3N4NaO2- — CID 178148885
sodium;3-(3-butyl-2-iminohept-3-enyl)-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea;1-chloro-2-methanidylbenzene (PubChem CID 178148885) has the molecular formula C29H36ClF3N4NaO2- and a molecular weight of 588.07 g/mol. Its IUPAC name is sodium;3-(3-butyl-2-iminohept-3-enyl)-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea;1-chloro-2-methanidylbenzene.
| Compound Name | sodium;3-(3-butyl-2-iminohept-3-enyl)-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea;1-chloro-2-methanidylbenzene |
|---|---|
| PubChem CID | 178148885 |
| Molecular Formula | C29H36ClF3N4NaO2- |
| Molecular Weight | 588.07 g/mol |
| Exact Mass | 587.24 |
| IUPAC Name | sodium;3-(3-butyl-2-iminohept-3-enyl)-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea;1-chloro-2-methanidylbenzene |
| SMILES | [CH2-]c1ccccc1Cl.[H]/N=C(/c1ccc(O)cc1)N(CCC(F)(F)F)C(=O)NCC(=N/[H])/C(=[C-]\CCC)CCCC.[Na+] |
| InChI | InChI=1S/C22H30F3N4O2.C7H6Cl.Na/c1-3-5-7-16(8-6-4-2)19(26)15-28-21(31)29(14-13-22(23,24)25)20(27)17-9-11-18(30)12-10-17;1-6-4-2-3-5-7(6)8;/h9-12,26-27,30H,3-7,13-15H2,1-2H3,(H,28,31);2-5H,1H2;/q2*-1;+1/b26-19-,27-20-;; |
| InChIKey | CLPPVAUTDVLSPF-RZRJUJGFSA-N |
| XLogP | 4.95 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.07 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|