C19H17F3NOP — CID 177030400
1-methyl-3-[(3-methyl-2-phosphanylphenyl)methyl]-4-(trifluoromethyl)quinolin-2-one (PubChem CID 177030400) has the molecular formula C19H17F3NOP and a molecular weight of 363.32 g/mol. Its IUPAC name is 1-methyl-3-[(3-methyl-2-phosphanylphenyl)methyl]-4-(trifluoromethyl)quinolin-2-one.
| Compound Name | 1-methyl-3-[(3-methyl-2-phosphanylphenyl)methyl]-4-(trifluoromethyl)quinolin-2-one |
|---|---|
| PubChem CID | 177030400 |
| Molecular Formula | C19H17F3NOP |
| Molecular Weight | 363.32 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 1-methyl-3-[(3-methyl-2-phosphanylphenyl)methyl]-4-(trifluoromethyl)quinolin-2-one |
| SMILES | Cc1cccc(Cc2c(C(F)(F)F)c3ccccc3n(C)c2=O)c1P |
| InChI | InChI=1S/C19H17F3NOP/c1-11-6-5-7-12(17(11)25)10-14-16(19(20,21)22)13-8-3-4-9-15(13)23(2)18(14)24/h3-9H,10,25H2,1-2H3 |
| InChIKey | ZWWNTINEUJWVHE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.32 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|