C16H19F3N2O — CID 170587653
6-[(dimethylamino)methyl]-3-ethyl-1-methyl-4-(trifluoromethyl)quinolin-2-one (PubChem CID 170587653) has the molecular formula C16H19F3N2O and a molecular weight of 312.34 g/mol. Its IUPAC name is 6-[(dimethylamino)methyl]-3-ethyl-1-methyl-4-(trifluoromethyl)quinolin-2-one.
| Compound Name | 6-[(dimethylamino)methyl]-3-ethyl-1-methyl-4-(trifluoromethyl)quinolin-2-one |
|---|---|
| PubChem CID | 170587653 |
| Molecular Formula | C16H19F3N2O |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 6-[(dimethylamino)methyl]-3-ethyl-1-methyl-4-(trifluoromethyl)quinolin-2-one |
| SMILES | CCc1c(C(F)(F)F)c2cc(CN(C)C)ccc2n(C)c1=O |
| InChI | InChI=1S/C16H19F3N2O/c1-5-11-14(16(17,18)19)12-8-10(9-20(2)3)6-7-13(12)21(4)15(11)22/h6-8H,5,9H2,1-4H3 |
| InChIKey | GPTPZXVSIHVCLK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |