C23H30BF3N2O5 — CID 177027513
tert-butyl N-[[1-methyl-2-oxo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)quinolin-6-yl]methyl]carbamate (PubChem CID 177027513) has the molecular formula C23H30BF3N2O5 and a molecular weight of 482.31 g/mol. Its IUPAC name is tert-butyl N-[[1-methyl-2-oxo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)quinolin-6-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-methyl-2-oxo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)quinolin-6-yl]methyl]carbamate |
|---|---|
| PubChem CID | 177027513 |
| Molecular Formula | C23H30BF3N2O5 |
| Molecular Weight | 482.31 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | tert-butyl N-[[1-methyl-2-oxo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)quinolin-6-yl]methyl]carbamate |
| SMILES | Cn1c(=O)c(B2OC(C)(C)C(C)(C)O2)c(C(F)(F)F)c2cc(CNC(=O)OC(C)(C)C)ccc21 |
| InChI | InChI=1S/C23H30BF3N2O5/c1-20(2,3)32-19(31)28-12-13-9-10-15-14(11-13)16(23(25,26)27)17(18(30)29(15)8)24-33-21(4,5)22(6,7)34-24/h9-11H,12H2,1-8H3,(H,28,31) |
| InChIKey | QHQMVTZLKHVFTD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.31 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|