C21H27BF3NO5 — CID 123924545
tert-butyl N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)-1-benzofuran-2-yl]methyl]carbamate (PubChem CID 123924545) has the molecular formula C21H27BF3NO5 and a molecular weight of 441.26 g/mol. Its IUPAC name is tert-butyl N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)-1-benzofuran-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)-1-benzofuran-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 123924545 |
| Molecular Formula | C21H27BF3NO5 |
| Molecular Weight | 441.26 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | tert-butyl N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)-1-benzofuran-2-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cc2c(B3OC(C)(C)C(C)(C)O3)cc(C(F)(F)F)cc2o1 |
| InChI | InChI=1S/C21H27BF3NO5/c1-18(2,3)29-17(27)26-11-13-10-14-15(22-30-19(4,5)20(6,7)31-22)8-12(21(23,24)25)9-16(14)28-13/h8-10H,11H2,1-7H3,(H,26,27) |
| InChIKey | FGPHJVWZKBQXFJ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 69.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.26 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|