C15H16BrNO4 — CID 135274182
tert-butyl N-[(7-bromo-4-oxochromen-2-yl)methyl]carbamate (PubChem CID 135274182) has the molecular formula C15H16BrNO4 and a molecular weight of 354.20 g/mol. Its IUPAC name is tert-butyl N-[(7-bromo-4-oxochromen-2-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(7-bromo-4-oxochromen-2-yl)methyl]carbamate |
|---|---|
| PubChem CID | 135274182 |
| Molecular Formula | C15H16BrNO4 |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | tert-butyl N-[(7-bromo-4-oxochromen-2-yl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cc(=O)c2ccc(Br)cc2o1 |
| InChI | InChI=1S/C15H16BrNO4/c1-15(2,3)21-14(19)17-8-10-7-12(18)11-5-4-9(16)6-13(11)20-10/h4-7H,8H2,1-3H3,(H,17,19) |
| InChIKey | QWJNJQAGXHJQET-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |