C18H28BNO6S — CID 177195823
methyl 5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylate (PubChem CID 177195823) has the molecular formula C18H28BNO6S and a molecular weight of 397.30 g/mol. Its IUPAC name is methyl 5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylate.
| Compound Name | methyl 5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 177195823 |
| Molecular Formula | C18H28BNO6S |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | methyl 5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylate |
| SMILES | COC(=O)c1cc(B2OC(C)(C)C(C)(C)O2)c(CNC(=O)OC(C)(C)C)s1 |
| InChI | InChI=1S/C18H28BNO6S/c1-16(2,3)24-15(22)20-10-13-11(9-12(27-13)14(21)23-8)19-25-17(4,5)18(6,7)26-19/h9H,10H2,1-8H3,(H,20,22) |
| InChIKey | QOXZPBQBSIOADE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|