C26H28FNO3 — CID 177032355
3-[5-[4-[(3-fluoropiperidin-1-yl)methyl]-2-methoxyphenyl]naphthalen-1-yl]propanoic acid (PubChem CID 177032355) has the molecular formula C26H28FNO3 and a molecular weight of 421.51 g/mol. Its IUPAC name is 3-[5-[4-[(3-fluoropiperidin-1-yl)methyl]-2-methoxyphenyl]naphthalen-1-yl]propanoic acid.
| Compound Name | 3-[5-[4-[(3-fluoropiperidin-1-yl)methyl]-2-methoxyphenyl]naphthalen-1-yl]propanoic acid |
|---|---|
| PubChem CID | 177032355 |
| Molecular Formula | C26H28FNO3 |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 3-[5-[4-[(3-fluoropiperidin-1-yl)methyl]-2-methoxyphenyl]naphthalen-1-yl]propanoic acid |
| SMILES | COc1cc(CN2CCCC(F)C2)ccc1-c1cccc2c(CCC(=O)O)cccc12 |
| InChI | InChI=1S/C26H28FNO3/c1-31-25-15-18(16-28-14-4-6-20(27)17-28)10-12-24(25)23-9-3-7-21-19(11-13-26(29)30)5-2-8-22(21)23/h2-3,5,7-10,12,15,20H,4,6,11,13-14,16-17H2,1H3,(H,29,30) |
| InChIKey | QULUZEVYXCGUNB-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |