C28H32F3NO — CID 177032913
1-[2-[3-methoxy-2-(5-propylnaphthalen-1-yl)phenyl]ethyl]-3-(trifluoromethyl)piperidine (PubChem CID 177032913) has the molecular formula C28H32F3NO and a molecular weight of 455.56 g/mol. Its IUPAC name is 1-[2-[3-methoxy-2-(5-propylnaphthalen-1-yl)phenyl]ethyl]-3-(trifluoromethyl)piperidine.
| Compound Name | 1-[2-[3-methoxy-2-(5-propylnaphthalen-1-yl)phenyl]ethyl]-3-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 177032913 |
| Molecular Formula | C28H32F3NO |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | 1-[2-[3-methoxy-2-(5-propylnaphthalen-1-yl)phenyl]ethyl]-3-(trifluoromethyl)piperidine |
| SMILES | CCCc1cccc2c(-c3c(CCN4CCCC(C(F)(F)F)C4)cccc3OC)cccc12 |
| InChI | InChI=1S/C28H32F3NO/c1-3-8-20-9-4-13-24-23(20)12-6-14-25(24)27-21(10-5-15-26(27)33-2)16-18-32-17-7-11-22(19-32)28(29,30)31/h4-6,9-10,12-15,22H,3,7-8,11,16-19H2,1-2H3 |
| InChIKey | KAMWMCVOGZUKAU-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |