C6H13F2KNO- — CID 177033178
potassium;carbanide;3-(dimethylamino)-2,2-difluoropropan-1-olate (PubChem CID 177033178) has the molecular formula C6H13F2KNO- and a molecular weight of 192.27 g/mol. Its IUPAC name is potassium;carbanide;3-(dimethylamino)-2,2-difluoropropan-1-olate.
| Compound Name | potassium;carbanide;3-(dimethylamino)-2,2-difluoropropan-1-olate |
|---|---|
| PubChem CID | 177033178 |
| Molecular Formula | C6H13F2KNO- |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | potassium;carbanide;3-(dimethylamino)-2,2-difluoropropan-1-olate |
| SMILES | CN(C)CC(F)(F)C[O-].[CH3-].[K+] |
| InChI | InChI=1S/C5H10F2NO.CH3.K/c1-8(2)3-5(6,7)4-9;;/h3-4H2,1-2H3;1H3;/q2*-1;+1 |
| InChIKey | QUGDYPAXDYMPFS-UHFFFAOYSA-N |
| XLogP | -3.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | -3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|