About 1-bromo-4-methylbenzene;but-3-en-2-one;1-methyl-2-(4-methylphenyl)benzene
1-bromo-4-methylbenzene;but-3-en-2-one;1-methyl-2-(4-methylphenyl)benzene (PubChem CID 177034699) has the molecular formula C25H27BrO
and a molecular weight of 423.39 g/mol. Its IUPAC name is 1-bromo-4-methylbenzene;but-3-en-2-one;1-methyl-2-(4-methylphenyl)benzene.
Molecular Properties
| Compound Name | 1-bromo-4-methylbenzene;but-3-en-2-one;1-methyl-2-(4-methylphenyl)benzene |
| PubChem CID | 177034699 |
| Molecular Formula | C25H27BrO |
| Molecular Weight | 423.39 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 1-bromo-4-methylbenzene;but-3-en-2-one;1-methyl-2-(4-methylphenyl)benzene |
| SMILES | C=CC(C)=O.Cc1ccc(-c2ccccc2C)cc1.Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C14H14.C7H7Br.C4H6O/c1-11-7-9-13(10-8-11)14-6-4-3-5-12(14)2;1-6-2-4-7(8)5-3-6;1-3-4(2)5/h3-10H,1-2H3;2-5H,1H3;3H,1H2,2H3 |
| InChIKey | CJABNEFJXKZQEG-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.39 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4-methylbenzene;but-3-en-2-one;1-methyl-2-(4-methylphenyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-methylbenzene;but-3-en-2-one;1-methyl-2-(4-methylphenyl)benzene?
The IUPAC name of 1-bromo-4-methylbenzene;but-3-en-2-one;1-methyl-2-(4-methylphenyl)benzene (CID 177034699) is 1-bromo-4-methylbenzene;but-3-en-2-one;1-methyl-2-(4-methylphenyl)benzene.
What is the SMILES notation for 1-bromo-4-methylbenzene;but-3-en-2-one;1-methyl-2-(4-methylphenyl)benzene?
The canonical SMILES for 1-bromo-4-methylbenzene;but-3-en-2-one;1-methyl-2-(4-methylphenyl)benzene is C=CC(C)=O.Cc1ccc(-c2ccccc2C)cc1.Cc1ccc(Br)cc1.
What is the InChIKey of 1-bromo-4-methylbenzene;but-3-en-2-one;1-methyl-2-(4-methylphenyl)benzene?
The InChIKey is CJABNEFJXKZQEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14.C7H7Br.C4H6O/c1-11-7-9-13(10-8-11)14-6-4-3-5-12(14)2;1-6-2-4-7(8)5-3-6;1-3-4(2)5/h3-10H,1-2H3;2-5H,1H3;3H,1H2,2H3.
What are the key properties of 1-bromo-4-methylbenzene;but-3-en-2-one;1-methyl-2-(4-methylphenyl)benzene?
1-bromo-4-methylbenzene;but-3-en-2-one;1-methyl-2-(4-methylphenyl)benzene has a molecular weight of 423.39 g/mol, XLogP of 7.49, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-methylbenzene;but-3-en-2-one;1-methyl-2-(4-methylphenyl)benzene is sourced from PubChem (CID 177034699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).