About 1-bromo-4-methyl-2-phenylbenzene;but-3-en-2-one;cumene
1-bromo-4-methyl-2-phenylbenzene;but-3-en-2-one;cumene (PubChem CID 177034851) has the molecular formula C26H29BrO
and a molecular weight of 437.42 g/mol. Its IUPAC name is 1-bromo-4-methyl-2-phenylbenzene;but-3-en-2-one;cumene.
Molecular Properties
| Compound Name | 1-bromo-4-methyl-2-phenylbenzene;but-3-en-2-one;cumene |
| PubChem CID | 177034851 |
| Molecular Formula | C26H29BrO |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 1-bromo-4-methyl-2-phenylbenzene;but-3-en-2-one;cumene |
| SMILES | C=CC(C)=O.CC(C)c1ccccc1.Cc1ccc(Br)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C13H11Br.C9H12.C4H6O/c1-10-7-8-13(14)12(9-10)11-5-3-2-4-6-11;1-8(2)9-6-4-3-5-7-9;1-3-4(2)5/h2-9H,1H3;3-8H,1-2H3;3H,1H2,2H3 |
| InChIKey | GQMZKGRPZHCTHJ-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4-methyl-2-phenylbenzene;but-3-en-2-one;cumene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-methyl-2-phenylbenzene;but-3-en-2-one;cumene?
The IUPAC name of 1-bromo-4-methyl-2-phenylbenzene;but-3-en-2-one;cumene (CID 177034851) is 1-bromo-4-methyl-2-phenylbenzene;but-3-en-2-one;cumene.
What is the SMILES notation for 1-bromo-4-methyl-2-phenylbenzene;but-3-en-2-one;cumene?
The canonical SMILES for 1-bromo-4-methyl-2-phenylbenzene;but-3-en-2-one;cumene is C=CC(C)=O.CC(C)c1ccccc1.Cc1ccc(Br)c(-c2ccccc2)c1.
What is the InChIKey of 1-bromo-4-methyl-2-phenylbenzene;but-3-en-2-one;cumene?
The InChIKey is GQMZKGRPZHCTHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11Br.C9H12.C4H6O/c1-10-7-8-13(14)12(9-10)11-5-3-2-4-6-11;1-8(2)9-6-4-3-5-7-9;1-3-4(2)5/h2-9H,1H3;3-8H,1-2H3;3H,1H2,2H3.
What are the key properties of 1-bromo-4-methyl-2-phenylbenzene;but-3-en-2-one;cumene?
1-bromo-4-methyl-2-phenylbenzene;but-3-en-2-one;cumene has a molecular weight of 437.42 g/mol, XLogP of 8.00, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-methyl-2-phenylbenzene;but-3-en-2-one;cumene is sourced from PubChem (CID 177034851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).