About 1-bromo-4-methyl-2-phenylbenzene;ethane;(4-methoxy-2-phenylphenyl)boronic acid
1-bromo-4-methyl-2-phenylbenzene;ethane;(4-methoxy-2-phenylphenyl)boronic acid (PubChem CID 161089691) has the molecular formula C28H30BBrO3
and a molecular weight of 505.26 g/mol. Its IUPAC name is 1-bromo-4-methyl-2-phenylbenzene;ethane;(4-methoxy-2-phenylphenyl)boronic acid.
Molecular Properties
| Compound Name | 1-bromo-4-methyl-2-phenylbenzene;ethane;(4-methoxy-2-phenylphenyl)boronic acid |
| PubChem CID | 161089691 |
| Molecular Formula | C28H30BBrO3 |
| Molecular Weight | 505.26 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | 1-bromo-4-methyl-2-phenylbenzene;ethane;(4-methoxy-2-phenylphenyl)boronic acid |
| SMILES | CC.COc1ccc(B(O)O)c(-c2ccccc2)c1.Cc1ccc(Br)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C13H13BO3.C13H11Br.C2H6/c1-17-11-7-8-13(14(15)16)12(9-11)10-5-3-2-4-6-10;1-10-7-8-13(14)12(9-10)11-5-3-2-4-6-11;1-2/h2-9,15-16H,1H3;2-9H,1H3;1-2H3 |
| InChIKey | UGZWFOFXBWYVIB-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 505.26 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4-methyl-2-phenylbenzene;ethane;(4-methoxy-2-phenylphenyl)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-methyl-2-phenylbenzene;ethane;(4-methoxy-2-phenylphenyl)boronic acid?
The IUPAC name of 1-bromo-4-methyl-2-phenylbenzene;ethane;(4-methoxy-2-phenylphenyl)boronic acid (CID 161089691) is 1-bromo-4-methyl-2-phenylbenzene;ethane;(4-methoxy-2-phenylphenyl)boronic acid.
What is the SMILES notation for 1-bromo-4-methyl-2-phenylbenzene;ethane;(4-methoxy-2-phenylphenyl)boronic acid?
The canonical SMILES for 1-bromo-4-methyl-2-phenylbenzene;ethane;(4-methoxy-2-phenylphenyl)boronic acid is CC.COc1ccc(B(O)O)c(-c2ccccc2)c1.Cc1ccc(Br)c(-c2ccccc2)c1.
What is the InChIKey of 1-bromo-4-methyl-2-phenylbenzene;ethane;(4-methoxy-2-phenylphenyl)boronic acid?
The InChIKey is UGZWFOFXBWYVIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13BO3.C13H11Br.C2H6/c1-17-11-7-8-13(14(15)16)12(9-11)10-5-3-2-4-6-10;1-10-7-8-13(14)12(9-10)11-5-3-2-4-6-11;1-2/h2-9,15-16H,1H3;2-9H,1H3;1-2H3.
What are the key properties of 1-bromo-4-methyl-2-phenylbenzene;ethane;(4-methoxy-2-phenylphenyl)boronic acid?
1-bromo-4-methyl-2-phenylbenzene;ethane;(4-methoxy-2-phenylphenyl)boronic acid has a molecular weight of 505.26 g/mol, XLogP of 6.49, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-methyl-2-phenylbenzene;ethane;(4-methoxy-2-phenylphenyl)boronic acid is sourced from PubChem (CID 161089691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).