C20H15Cl3N2O4 — CID 177035419
6-[(6-chloro-2-pyridinyl)methoxy]-2-(3,4-dichlorophenyl)-1-ethyl-4-oxopyridine-3-carboxylic acid (PubChem CID 177035419) has the molecular formula C20H15Cl3N2O4 and a molecular weight of 453.71 g/mol. Its IUPAC name is 6-[(6-chloro-2-pyridinyl)methoxy]-2-(3,4-dichlorophenyl)-1-ethyl-4-oxopyridine-3-carboxylic acid.
| Compound Name | 6-[(6-chloro-2-pyridinyl)methoxy]-2-(3,4-dichlorophenyl)-1-ethyl-4-oxopyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 177035419 |
| Molecular Formula | C20H15Cl3N2O4 |
| Molecular Weight | 453.71 g/mol |
| Exact Mass | 452.01 |
| IUPAC Name | 6-[(6-chloro-2-pyridinyl)methoxy]-2-(3,4-dichlorophenyl)-1-ethyl-4-oxopyridine-3-carboxylic acid |
| SMILES | CCn1c(OCc2cccc(Cl)n2)cc(=O)c(C(=O)O)c1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H15Cl3N2O4/c1-2-25-17(29-10-12-4-3-5-16(23)24-12)9-15(26)18(20(27)28)19(25)11-6-7-13(21)14(22)8-11/h3-9H,2,10H2,1H3,(H,27,28) |
| InChIKey | WXVMMOWYGQBWSR-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.71 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|