C10H19N3 — CID 177038211
2-(1-propan-2-yl-1,4-diazepan-5-yl)acetonitrile (PubChem CID 177038211) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is 2-(1-propan-2-yl-1,4-diazepan-5-yl)acetonitrile.
| Compound Name | 2-(1-propan-2-yl-1,4-diazepan-5-yl)acetonitrile |
|---|---|
| PubChem CID | 177038211 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | 2-(1-propan-2-yl-1,4-diazepan-5-yl)acetonitrile |
| SMILES | CC(C)N1CCNC(CC#N)CC1 |
| InChI | InChI=1S/C10H19N3/c1-9(2)13-7-4-10(3-5-11)12-6-8-13/h9-10,12H,3-4,6-8H2,1-2H3 |
| InChIKey | JCGJBNKYXSHUCR-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |