C11H13FN2O3 — CID 177039491
(Z)-N-(2,6-dioxopiperidin-3-yl)-2-ethenyl-3-fluorobut-2-enamide (PubChem CID 177039491) has the molecular formula C11H13FN2O3 and a molecular weight of 240.23 g/mol. Its IUPAC name is (Z)-N-(2,6-dioxopiperidin-3-yl)-2-ethenyl-3-fluorobut-2-enamide.
| Compound Name | (Z)-N-(2,6-dioxopiperidin-3-yl)-2-ethenyl-3-fluorobut-2-enamide |
|---|---|
| PubChem CID | 177039491 |
| Molecular Formula | C11H13FN2O3 |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | (Z)-N-(2,6-dioxopiperidin-3-yl)-2-ethenyl-3-fluorobut-2-enamide |
| SMILES | C=C/C(C(=O)NC1CCC(=O)NC1=O)=C(\C)F |
| InChI | InChI=1S/C11H13FN2O3/c1-3-7(6(2)12)10(16)13-8-4-5-9(15)14-11(8)17/h3,8H,1,4-5H2,2H3,(H,13,16)(H,14,15,17)/b7-6- |
| InChIKey | OUSVDILKIFXRFR-SREVYHEPSA-N |
| XLogP | 0.34 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|