C10H15FN2O2 — CID 147501193
3-[[(2Z)-2-(fluoromethylidene)butyl]amino]piperidine-2,6-dione (PubChem CID 147501193) has the molecular formula C10H15FN2O2 and a molecular weight of 214.24 g/mol. Its IUPAC name is 3-[[(2Z)-2-(fluoromethylidene)butyl]amino]piperidine-2,6-dione.
| Compound Name | 3-[[(2Z)-2-(fluoromethylidene)butyl]amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 147501193 |
| Molecular Formula | C10H15FN2O2 |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 3-[[(2Z)-2-(fluoromethylidene)butyl]amino]piperidine-2,6-dione |
| SMILES | CC/C(=C/F)CNC1CCC(=O)NC1=O |
| InChI | InChI=1S/C10H15FN2O2/c1-2-7(5-11)6-12-8-3-4-9(14)13-10(8)15/h5,8,12H,2-4,6H2,1H3,(H,13,14,15)/b7-5- |
| InChIKey | FHLHIFNCVPDZDE-ALCCZGGFSA-N |
| XLogP | 0.64 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|