C10H13FN2O4 — CID 154957631
[(2,6-dioxopiperidin-3-yl)-(2-methylprop-2-enoyl)amino]methyl hypofluorite (PubChem CID 154957631) has the molecular formula C10H13FN2O4 and a molecular weight of 244.22 g/mol. Its IUPAC name is [(2,6-dioxopiperidin-3-yl)-(2-methylprop-2-enoyl)amino]methyl hypofluorite.
| Compound Name | [(2,6-dioxopiperidin-3-yl)-(2-methylprop-2-enoyl)amino]methyl hypofluorite |
|---|---|
| PubChem CID | 154957631 |
| Molecular Formula | C10H13FN2O4 |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | [(2,6-dioxopiperidin-3-yl)-(2-methylprop-2-enoyl)amino]methyl hypofluorite |
| SMILES | C=C(C)C(=O)N(COF)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C10H13FN2O4/c1-6(2)10(16)13(5-17-11)7-3-4-8(14)12-9(7)15/h7H,1,3-5H2,2H3,(H,12,14,15) |
| InChIKey | XTQCDCQEJCIPQO-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|