C11H17FN2O2 — CID 167275854
3-[[2-(fluoromethyl)-3-methylbut-2-enyl]amino]piperidine-2,6-dione (PubChem CID 167275854) has the molecular formula C11H17FN2O2 and a molecular weight of 228.27 g/mol. Its IUPAC name is 3-[[2-(fluoromethyl)-3-methylbut-2-enyl]amino]piperidine-2,6-dione.
| Compound Name | 3-[[2-(fluoromethyl)-3-methylbut-2-enyl]amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167275854 |
| Molecular Formula | C11H17FN2O2 |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 3-[[2-(fluoromethyl)-3-methylbut-2-enyl]amino]piperidine-2,6-dione |
| SMILES | CC(C)=C(CF)CNC1CCC(=O)NC1=O |
| InChI | InChI=1S/C11H17FN2O2/c1-7(2)8(5-12)6-13-9-3-4-10(15)14-11(9)16/h9,13H,3-6H2,1-2H3,(H,14,15,16) |
| InChIKey | PORYMGZUKSKUOX-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|