C21H37N3O — CID 177040837
butanal;ethane;7-(2-methyl-3-propyl-4-pyridinyl)-4,7-diazaspiro[2.5]octane (PubChem CID 177040837) has the molecular formula C21H37N3O and a molecular weight of 347.55 g/mol. Its IUPAC name is butanal;ethane;7-(2-methyl-3-propyl-4-pyridinyl)-4,7-diazaspiro[2.5]octane.
| Compound Name | butanal;ethane;7-(2-methyl-3-propyl-4-pyridinyl)-4,7-diazaspiro[2.5]octane |
|---|---|
| PubChem CID | 177040837 |
| Molecular Formula | C21H37N3O |
| Molecular Weight | 347.55 g/mol |
| Exact Mass | 347.29 |
| IUPAC Name | butanal;ethane;7-(2-methyl-3-propyl-4-pyridinyl)-4,7-diazaspiro[2.5]octane |
| SMILES | CC.CCCC=O.CCCc1c(N2CCNC3(CC3)C2)ccnc1C |
| InChI | InChI=1S/C15H23N3.C4H8O.C2H6/c1-3-4-13-12(2)16-8-5-14(13)18-10-9-17-15(11-18)6-7-15;1-2-3-4-5;1-2/h5,8,17H,3-4,6-7,9-11H2,1-2H3;4H,2-3H2,1H3;1-2H3 |
| InChIKey | ATFHJXNOMTYRPZ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.55 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|