C19H32N2O — CID 177040578
2-methyl-4-[(3R)-3-methylpyrrolidin-1-yl]-3-propylpyridine;pentan-2-one (PubChem CID 177040578) has the molecular formula C19H32N2O and a molecular weight of 304.48 g/mol. Its IUPAC name is 2-methyl-4-[(3R)-3-methylpyrrolidin-1-yl]-3-propylpyridine;pentan-2-one.
| Compound Name | 2-methyl-4-[(3R)-3-methylpyrrolidin-1-yl]-3-propylpyridine;pentan-2-one |
|---|---|
| PubChem CID | 177040578 |
| Molecular Formula | C19H32N2O |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.25 |
| IUPAC Name | 2-methyl-4-[(3R)-3-methylpyrrolidin-1-yl]-3-propylpyridine;pentan-2-one |
| SMILES | CCCC(C)=O.CCCc1c(N2CC[C@@H](C)C2)ccnc1C |
| InChI | InChI=1S/C14H22N2.C5H10O/c1-4-5-13-12(3)15-8-6-14(13)16-9-7-11(2)10-16;1-3-4-5(2)6/h6,8,11H,4-5,7,9-10H2,1-3H3;3-4H2,1-2H3/t11-;/m1./s1 |
| InChIKey | GPDGRSHWEKDMDH-RFVHGSKJSA-N |
| XLogP | 4.56 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |