About 2-methyl-4-[(3R)-3-methylpyrrolidin-1-yl]-3-propylpyridine;pentan-2-one
2-methyl-4-[(3R)-3-methylpyrrolidin-1-yl]-3-propylpyridine;pentan-2-one (PubChem CID 177040578) has the molecular formula C19H32N2O
and a molecular weight of 304.48 g/mol. Its IUPAC name is 2-methyl-4-[(3R)-3-methylpyrrolidin-1-yl]-3-propylpyridine;pentan-2-one.
Molecular Properties
| Compound Name | 2-methyl-4-[(3R)-3-methylpyrrolidin-1-yl]-3-propylpyridine;pentan-2-one |
| PubChem CID | 177040578 |
| Molecular Formula | C19H32N2O |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.25 |
| IUPAC Name | 2-methyl-4-[(3R)-3-methylpyrrolidin-1-yl]-3-propylpyridine;pentan-2-one |
| SMILES | CCCC(C)=O.CCCc1c(N2CC[C@@H](C)C2)ccnc1C |
| InChI | InChI=1S/C14H22N2.C5H10O/c1-4-5-13-12(3)15-8-6-14(13)16-9-7-11(2)10-16;1-3-4-5(2)6/h6,8,11H,4-5,7,9-10H2,1-3H3;3-4H2,1-2H3/t11-;/m1./s1 |
| InChIKey | GPDGRSHWEKDMDH-RFVHGSKJSA-N |
| XLogP | 4.56 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-4-[(3R)-3-methylpyrrolidin-1-yl]-3-propylpyridine;pentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-[(3R)-3-methylpyrrolidin-1-yl]-3-propylpyridine;pentan-2-one?
The IUPAC name of 2-methyl-4-[(3R)-3-methylpyrrolidin-1-yl]-3-propylpyridine;pentan-2-one (CID 177040578) is 2-methyl-4-[(3R)-3-methylpyrrolidin-1-yl]-3-propylpyridine;pentan-2-one.
What is the SMILES notation for 2-methyl-4-[(3R)-3-methylpyrrolidin-1-yl]-3-propylpyridine;pentan-2-one?
The canonical SMILES for 2-methyl-4-[(3R)-3-methylpyrrolidin-1-yl]-3-propylpyridine;pentan-2-one is CCCC(C)=O.CCCc1c(N2CC[C@@H](C)C2)ccnc1C.
What is the InChIKey of 2-methyl-4-[(3R)-3-methylpyrrolidin-1-yl]-3-propylpyridine;pentan-2-one?
The InChIKey is GPDGRSHWEKDMDH-RFVHGSKJSA-N. The full InChI is InChI=1S/C14H22N2.C5H10O/c1-4-5-13-12(3)15-8-6-14(13)16-9-7-11(2)10-16;1-3-4-5(2)6/h6,8,11H,4-5,7,9-10H2,1-3H3;3-4H2,1-2H3/t11-;/m1./s1.
What are the key properties of 2-methyl-4-[(3R)-3-methylpyrrolidin-1-yl]-3-propylpyridine;pentan-2-one?
2-methyl-4-[(3R)-3-methylpyrrolidin-1-yl]-3-propylpyridine;pentan-2-one has a molecular weight of 304.48 g/mol, XLogP of 4.56, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-[(3R)-3-methylpyrrolidin-1-yl]-3-propylpyridine;pentan-2-one is sourced from PubChem (CID 177040578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).