C15H28N2 — CID 177040879
N'-[(Z)-but-2-en-2-yl]-N-[(Z)-3-methylpent-3-en-2-ylidene]propanimidamide;ethane (PubChem CID 177040879) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is N'-[(Z)-but-2-en-2-yl]-N-[(Z)-3-methylpent-3-en-2-ylidene]propanimidamide;ethane.
| Compound Name | N'-[(Z)-but-2-en-2-yl]-N-[(Z)-3-methylpent-3-en-2-ylidene]propanimidamide;ethane |
|---|---|
| PubChem CID | 177040879 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | N'-[(Z)-but-2-en-2-yl]-N-[(Z)-3-methylpent-3-en-2-ylidene]propanimidamide;ethane |
| SMILES | C/C=C(C)\N=C(CC)\N=C(C)\C(C)=C/C.CC |
| InChI | InChI=1S/C13H22N2.C2H6/c1-7-10(4)12(6)15-13(9-3)14-11(5)8-2;1-2/h7-8H,9H2,1-6H3;1-2H3/b10-7-,11-8-,14-13+,15-12+; |
| InChIKey | WFPMQGOJDZTSKH-GBNHPPEPSA-N |
| XLogP | 5.17 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|