C22H34N2 — CID 142539044
ethane;N-[(3E)-3-ethenylhexa-3,5-dien-2-ylidene]-N'-[(3E)-3-[(Z)-prop-1-enyl]hexa-1,3-dien-2-yl]propanimidamide (PubChem CID 142539044) has the molecular formula C22H34N2 and a molecular weight of 326.53 g/mol. Its IUPAC name is ethane;N-[(3E)-3-ethenylhexa-3,5-dien-2-ylidene]-N'-[(3E)-3-[(Z)-prop-1-enyl]hexa-1,3-dien-2-yl]propanimidamide.
| Compound Name | ethane;N-[(3E)-3-ethenylhexa-3,5-dien-2-ylidene]-N'-[(3E)-3-[(Z)-prop-1-enyl]hexa-1,3-dien-2-yl]propanimidamide |
|---|---|
| PubChem CID | 142539044 |
| Molecular Formula | C22H34N2 |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.27 |
| IUPAC Name | ethane;N-[(3E)-3-ethenylhexa-3,5-dien-2-ylidene]-N'-[(3E)-3-[(Z)-prop-1-enyl]hexa-1,3-dien-2-yl]propanimidamide |
| SMILES | C=C/C=C(C=C)/C(C)=N/C(CC)=N/C(=C)C(C=CC)=CCC.CC |
| InChI | InChI=1S/C20H28N2.C2H6/c1-8-13-18(11-4)16(6)21-20(12-5)22-17(7)19(14-9-2)15-10-3;1-2/h8-9,11,13-15H,1,4,7,10,12H2,2-3,5-6H3;1-2H3/b14-9-,18-13+,19-15+,21-16+,22-20+; |
| InChIKey | WPRVINLFZHRPNY-CLXSSTLESA-N |
| XLogP | 7.01 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|