C13H17N3 — CID 123454928
N-[(5E)-5,6-di(ethylidene)pyrimidin-4-yl]pent-1-en-3-imine (PubChem CID 123454928) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is N-[(5E)-5,6-di(ethylidene)pyrimidin-4-yl]pent-1-en-3-imine.
| Compound Name | N-[(5E)-5,6-di(ethylidene)pyrimidin-4-yl]pent-1-en-3-imine |
|---|---|
| PubChem CID | 123454928 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | N-[(5E)-5,6-di(ethylidene)pyrimidin-4-yl]pent-1-en-3-imine |
| SMILES | C=C/C(CC)=N\c1ncnc(=CC)/c1=C\C |
| InChI | InChI=1S/C13H17N3/c1-5-10(6-2)16-13-11(7-3)12(8-4)14-9-15-13/h5,7-9H,1,6H2,2-4H3/b11-7+,12-8?,16-10+ |
| InChIKey | GXMXOEJVZXSNQR-HVOMVDJESA-N |
| XLogP | 1.75 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|