C10H14N2 — CID 130351162
(4E,5E)-4,5-di(ethylidene)-2,6-dimethylpyrimidine (PubChem CID 130351162) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is (4E,5E)-4,5-di(ethylidene)-2,6-dimethylpyrimidine.
| Compound Name | (4E,5E)-4,5-di(ethylidene)-2,6-dimethylpyrimidine |
|---|---|
| PubChem CID | 130351162 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | (4E,5E)-4,5-di(ethylidene)-2,6-dimethylpyrimidine |
| SMILES | C/C=c1/c(C)nc(C)n/c1=C/C |
| InChI | InChI=1S/C10H14N2/c1-5-9-7(3)11-8(4)12-10(9)6-2/h5-6H,1-4H3/b9-5-,10-6+ |
| InChIKey | FGTNTNVGMUZSRA-VTBWALSUSA-N |
| XLogP | 0.69 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |