C10H15N3 — CID 90872144
methanamine;4-methyl-6,7-dihydroquinazoline (PubChem CID 90872144) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is methanamine;4-methyl-6,7-dihydroquinazoline.
| Compound Name | methanamine;4-methyl-6,7-dihydroquinazoline |
|---|---|
| PubChem CID | 90872144 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | methanamine;4-methyl-6,7-dihydroquinazoline |
| SMILES | CN.Cc1ncnc2c1=CCCC=2 |
| InChI | InChI=1S/C9H10N2.CH5N/c1-7-8-4-2-3-5-9(8)11-6-10-7;1-2/h4-6H,2-3H2,1H3;2H2,1H3 |
| InChIKey | UBFGADQJCXAINU-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |