About 4-methyl-6,7-dihydroquinazoline;methylhydrazine
4-methyl-6,7-dihydroquinazoline;methylhydrazine (PubChem CID 91531974) has the molecular formula C10H16N4
and a molecular weight of 192.27 g/mol. Its IUPAC name is 4-methyl-6,7-dihydroquinazoline;methylhydrazine.
Molecular Properties
| Compound Name | 4-methyl-6,7-dihydroquinazoline;methylhydrazine |
| PubChem CID | 91531974 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 4-methyl-6,7-dihydroquinazoline;methylhydrazine |
| SMILES | CNN.Cc1ncnc2c1=CCCC=2 |
| InChI | InChI=1S/C9H10N2.CH6N2/c1-7-8-4-2-3-5-9(8)11-6-10-7;1-3-2/h4-6H,2-3H2,1H3;3H,2H2,1H3 |
| InChIKey | VMHCMVJSBISVDE-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-6,7-dihydroquinazoline;methylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-6,7-dihydroquinazoline;methylhydrazine?
The IUPAC name of 4-methyl-6,7-dihydroquinazoline;methylhydrazine (CID 91531974) is 4-methyl-6,7-dihydroquinazoline;methylhydrazine.
What is the SMILES notation for 4-methyl-6,7-dihydroquinazoline;methylhydrazine?
The canonical SMILES for 4-methyl-6,7-dihydroquinazoline;methylhydrazine is CNN.Cc1ncnc2c1=CCCC=2.
What is the InChIKey of 4-methyl-6,7-dihydroquinazoline;methylhydrazine?
The InChIKey is VMHCMVJSBISVDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2.CH6N2/c1-7-8-4-2-3-5-9(8)11-6-10-7;1-3-2/h4-6H,2-3H2,1H3;3H,2H2,1H3.
What are the key properties of 4-methyl-6,7-dihydroquinazoline;methylhydrazine?
4-methyl-6,7-dihydroquinazoline;methylhydrazine has a molecular weight of 192.27 g/mol, XLogP of -0.78, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-6,7-dihydroquinazoline;methylhydrazine is sourced from PubChem (CID 91531974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).