C9H10N2 — CID 59065946
4-methyl-6,7-dihydroquinazoline (PubChem CID 59065946) has the molecular formula C9H10N2 and a molecular weight of 146.19 g/mol. Its IUPAC name is 4-methyl-6,7-dihydroquinazoline.
| Compound Name | 4-methyl-6,7-dihydroquinazoline |
|---|---|
| PubChem CID | 59065946 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 4-methyl-6,7-dihydroquinazoline |
| SMILES | Cc1ncnc2c1=CCCC=2 |
| InChI | InChI=1S/C9H10N2/c1-7-8-4-2-3-5-9(8)11-6-10-7/h4-6H,2-3H2,1H3 |
| InChIKey | VZQLTXWWXCTCHC-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |