C10H13FN2 — CID 91279701
fluoromethane;4-methyl-6,7-dihydroquinazoline (PubChem CID 91279701) has the molecular formula C10H13FN2 and a molecular weight of 180.23 g/mol. Its IUPAC name is fluoromethane;4-methyl-6,7-dihydroquinazoline.
| Compound Name | fluoromethane;4-methyl-6,7-dihydroquinazoline |
|---|---|
| PubChem CID | 91279701 |
| Molecular Formula | C10H13FN2 |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | fluoromethane;4-methyl-6,7-dihydroquinazoline |
| SMILES | CF.Cc1ncnc2c1=CCCC=2 |
| InChI | InChI=1S/C9H10N2.CH3F/c1-7-8-4-2-3-5-9(8)11-6-10-7;1-2/h4-6H,2-3H2,1H3;1H3 |
| InChIKey | JGXMEAGJBLJAKZ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |