About methylboronic acid;4-methyl-6,7-dihydroquinazoline
methylboronic acid;4-methyl-6,7-dihydroquinazoline (PubChem CID 91469651) has the molecular formula C10H15BN2O2
and a molecular weight of 206.05 g/mol. Its IUPAC name is methylboronic acid;4-methyl-6,7-dihydroquinazoline.
Molecular Properties
| Compound Name | methylboronic acid;4-methyl-6,7-dihydroquinazoline |
| PubChem CID | 91469651 |
| Molecular Formula | C10H15BN2O2 |
| Molecular Weight | 206.05 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | methylboronic acid;4-methyl-6,7-dihydroquinazoline |
| SMILES | CB(O)O.Cc1ncnc2c1=CCCC=2 |
| InChI | InChI=1S/C9H10N2.CH5BO2/c1-7-8-4-2-3-5-9(8)11-6-10-7;1-2(3)4/h4-6H,2-3H2,1H3;3-4H,1H3 |
| InChIKey | LZIGXYZFZXUVPR-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.05 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methylboronic acid;4-methyl-6,7-dihydroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylboronic acid;4-methyl-6,7-dihydroquinazoline?
The IUPAC name of methylboronic acid;4-methyl-6,7-dihydroquinazoline (CID 91469651) is methylboronic acid;4-methyl-6,7-dihydroquinazoline.
What is the SMILES notation for methylboronic acid;4-methyl-6,7-dihydroquinazoline?
The canonical SMILES for methylboronic acid;4-methyl-6,7-dihydroquinazoline is CB(O)O.Cc1ncnc2c1=CCCC=2.
What is the InChIKey of methylboronic acid;4-methyl-6,7-dihydroquinazoline?
The InChIKey is LZIGXYZFZXUVPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2.CH5BO2/c1-7-8-4-2-3-5-9(8)11-6-10-7;1-2(3)4/h4-6H,2-3H2,1H3;3-4H,1H3.
What are the key properties of methylboronic acid;4-methyl-6,7-dihydroquinazoline?
methylboronic acid;4-methyl-6,7-dihydroquinazoline has a molecular weight of 206.05 g/mol, XLogP of -0.77, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methylboronic acid;4-methyl-6,7-dihydroquinazoline is sourced from PubChem (CID 91469651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).