C18H20N2 — CID 134345768
5,10-dimethylidene-4-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-1,3-diazecine (PubChem CID 134345768) has the molecular formula C18H20N2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 5,10-dimethylidene-4-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-1,3-diazecine.
| Compound Name | 5,10-dimethylidene-4-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-1,3-diazecine |
|---|---|
| PubChem CID | 134345768 |
| Molecular Formula | C18H20N2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 5,10-dimethylidene-4-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-1,3-diazecine |
| SMILES | C=c1ccccc(=C)c(C(/C=C\C)=C/C=C\C)ncn1 |
| InChI | InChI=1S/C18H20N2/c1-5-7-13-17(10-6-2)18-15(3)11-8-9-12-16(4)19-14-20-18/h5-14H,3-4H2,1-2H3/b7-5-,10-6-,11-8+,12-9-,17-13+,19-14+,20-18+ |
| InChIKey | CQMNKAUEHZEVIP-COWFMZNHSA-N |
| XLogP | 2.96 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|