C16H28N2O3 — CID 177041106
3-methyl-2-[1-[1-(2,2,4-trimethylpiperazin-1-yl)ethenoxy]ethoxy]but-1-en-1-one (PubChem CID 177041106) has the molecular formula C16H28N2O3 and a molecular weight of 296.41 g/mol. Its IUPAC name is 3-methyl-2-[1-[1-(2,2,4-trimethylpiperazin-1-yl)ethenoxy]ethoxy]but-1-en-1-one.
| Compound Name | 3-methyl-2-[1-[1-(2,2,4-trimethylpiperazin-1-yl)ethenoxy]ethoxy]but-1-en-1-one |
|---|---|
| PubChem CID | 177041106 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | 3-methyl-2-[1-[1-(2,2,4-trimethylpiperazin-1-yl)ethenoxy]ethoxy]but-1-en-1-one |
| SMILES | C=C(OC(C)OC(=C=O)C(C)C)N1CCN(C)CC1(C)C |
| InChI | InChI=1S/C16H28N2O3/c1-12(2)15(10-19)21-14(4)20-13(3)18-9-8-17(7)11-16(18,5)6/h12,14H,3,8-9,11H2,1-2,4-7H3 |
| InChIKey | PACXGRWJLDLZMS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|