About N-[2-[(Z)-but-2-en-2-yl]iminohexan-3-ylidene]-N'-methylethanimidamide;ethane
N-[2-[(Z)-but-2-en-2-yl]iminohexan-3-ylidene]-N'-methylethanimidamide;ethane (PubChem CID 177041296) has the molecular formula C15H29N3
and a molecular weight of 251.42 g/mol. Its IUPAC name is N-[2-[(Z)-but-2-en-2-yl]iminohexan-3-ylidene]-N'-methylethanimidamide;ethane.
Molecular Properties
| Compound Name | N-[2-[(Z)-but-2-en-2-yl]iminohexan-3-ylidene]-N'-methylethanimidamide;ethane |
| PubChem CID | 177041296 |
| Molecular Formula | C15H29N3 |
| Molecular Weight | 251.42 g/mol |
| Exact Mass | 251.24 |
| IUPAC Name | N-[2-[(Z)-but-2-en-2-yl]iminohexan-3-ylidene]-N'-methylethanimidamide;ethane |
| SMILES | C/C=C(C)\N=C(C)\C(CCC)=N\C(C)=N\C.CC |
| InChI | InChI=1S/C13H23N3.C2H6/c1-7-9-13(16-12(5)14-6)11(4)15-10(3)8-2;1-2/h8H,7,9H2,1-6H3;1-2H3/b10-8-,14-12+,15-11+,16-13+; |
| InChIKey | XVBAJSLMWOFHOX-UYSZJCCXSA-N |
| XLogP | 4.69 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.42 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[(Z)-but-2-en-2-yl]iminohexan-3-ylidene]-N'-methylethanimidamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(Z)-but-2-en-2-yl]iminohexan-3-ylidene]-N'-methylethanimidamide;ethane?
The IUPAC name of N-[2-[(Z)-but-2-en-2-yl]iminohexan-3-ylidene]-N'-methylethanimidamide;ethane (CID 177041296) is N-[2-[(Z)-but-2-en-2-yl]iminohexan-3-ylidene]-N'-methylethanimidamide;ethane.
What is the SMILES notation for N-[2-[(Z)-but-2-en-2-yl]iminohexan-3-ylidene]-N'-methylethanimidamide;ethane?
The canonical SMILES for N-[2-[(Z)-but-2-en-2-yl]iminohexan-3-ylidene]-N'-methylethanimidamide;ethane is C/C=C(C)\N=C(C)\C(CCC)=N\C(C)=N\C.CC.
What is the InChIKey of N-[2-[(Z)-but-2-en-2-yl]iminohexan-3-ylidene]-N'-methylethanimidamide;ethane?
The InChIKey is XVBAJSLMWOFHOX-UYSZJCCXSA-N. The full InChI is InChI=1S/C13H23N3.C2H6/c1-7-9-13(16-12(5)14-6)11(4)15-10(3)8-2;1-2/h8H,7,9H2,1-6H3;1-2H3/b10-8-,14-12+,15-11+,16-13+;.
What are the key properties of N-[2-[(Z)-but-2-en-2-yl]iminohexan-3-ylidene]-N'-methylethanimidamide;ethane?
N-[2-[(Z)-but-2-en-2-yl]iminohexan-3-ylidene]-N'-methylethanimidamide;ethane has a molecular weight of 251.42 g/mol, XLogP of 4.69, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(Z)-but-2-en-2-yl]iminohexan-3-ylidene]-N'-methylethanimidamide;ethane is sourced from PubChem (CID 177041296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).